The chemical structure of acrylates is characterized by a vinyl group (CH2=CH-) attached to a carboxylate ester group (-COO-R), where R represents an alkyl or aryl group, determining the specific type of acrylate. For example, 2-ethylhexyl acrylate has the structure CH2=CH-COO-CH2CH(C2H5)(CH2)3CH3, with R being a 2-ethylhexyl chain, while methyl acrylate has R as a methyl group (CH3). This structure gives acrylates their key properties: the reactive vinyl double bond enables polymerization, allowing acrylates to form long-chain polymers through free radical or other polymerization mechanisms, while the ester group influences properties such as polarity, flexibility, and chemical resistance. The length and branching of the R group affect the glass transition temperature (Tg) of the polymer—longer, branched alkyl chains (like in 2-ethylhexyl acrylate) lower the Tg, resulting in more flexible polymers, while shorter, linear chains (like in methyl acrylate) increase the Tg, producing harder, more rigid polymers. The presence of polar groups in some acrylates (e.g., acrylic acid, which has a -COOH group instead of -COO-R) enhances adhesion to polar substrates and allows for crosslinking, improving chemical and heat resistance. This modular chemical structure allows for a wide range of acrylate monomers, each with tailored properties, which can be copolymerized to create polymers with specific performance characteristics, making acrylates highly versatile for adhesives, coatings, and other applications. E Plus Chemical Co., Ltd. utilizes this structural versatility to produce a range of acrylates, leveraging advanced synthesis techniques to ensure consistent quality and performance.
17
Jul
17
Jul
21
Jul
17
Jul
EN
